Short description: Organomercury antiseptic and antifungal agent Thiomersal Names IUPAC name Ethyl(2-mercaptobenzoato-(2-)-O,S) mercurate(1-) sodium Other names Mercury((o-carboxyphenyl)thio)ethyl sodium salt, sodium ethylmercurithiosalicylate Identifiers CAS Number * 54-64-8 Y 3D model (JSmol) * Interactive image Beilstein Reference | 8169555 ChEBI | * CHEBI:9546 Y ChEMBL | * ChEMBL508338 Y ChemSpider | * 10772045 Y DrugBank | * DB11590 EC Number | * 200-210-4 Gmelin Reference | 1677155 KEGG | * D00864 PubChem CID * 16684434 RTECS number | * OV8400000 UNII | * 2225PI3MOV Y InChI * InChI=1S/C7H6O2S.C2H5.Hg.Na/c8-7(9)5-3-1-2-4-6(5)10;1-2;;/h1-4,10H,(H,8,9);1H2,2H3;;/q;;2*+1/p-2 Y Key: RTKIYNMVFMVABJ-UHFFFAOYSA-L Y * InChI=1/C7H6O2S.C2H5.Hg.Na/c8-7(9)5-3-1-2-4-6(5)10;1-2;;/h1-4,10H,(H,8,9);1H2,2H3;;/q;;2*+1/p-2/rC9H10HgO2S.Na/c1-2-10-13-8-6-4-3-5-7(8)9(11)12;/h3-6H,2H2,1H3,(H,11,12);/q;+1/p-1 Key: RTKIYNMVFMVABJ-TYXNQWANAP SMILES * [Na+].[O-]C(=O)c1ccccc1S[Hg]CC Properties Chemical formula | C9H9HgNaO2S Molar mass | 404.81 g/mol Appearance | White or slightly yellow powder Density | 2.508 g/cm3[1] Melting point | 232 to 233 °C (450 to 451 °F; 505 to 506 K) (decomposition) Solubility in water | 1000 g/L (20 °C) Pharmacology 1=ATC code }} | D08AK06 (WHO) Hazards Safety data sheet | External MSDS GHS pictograms | GHS Signal word | Danger GHS hazard statements | H300, H310, H330, H373, H410 GHS precautionary statements | P260, P273, P280, P301, P310, P330, P302, P352, P304, P340[2] NFPA 704 (fire diamond) | Flash point | 250 °C (482 °F; 523 K) Lethal dose or concentration (LD, LC): LD50 (median dose) | 75 mg/kg (oral, rat)[3] Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Y verify (what is YN ?) Infobox references Thiomersal (INN), or thimerosal (USAN, JAN), is an organomercury compound. It is a well-established antiseptic and antifungal agent. The pharmaceutical corporation Eli Lilly and Company gave thiomersal the trade name Merthiolate. It has been used as a preservative in vaccines, immunoglobulin preparations, skin test antigens, antivenins, ophthalmic and nasal products, and tattoo inks.[4] In spite of the scientific consensus that fears about its safety are unsubstantiated,[5][6][7][8] its use as a vaccine preservative was called into question by anti-vaccination groups, and it was phased out from routine childhood vaccines in the United States, the European Union, and a few other countries in response to popular fears.[9] ## Contents * 1 History * 2 Structure * 3 Uses * 4 Toxicology * 4.1 General toxicity * 4.2 As an allergen * 4.3 Disproven autism hypothesis * 5 See also * 6 References ## History Morris Kharasch, a chemist then at the University of Maryland filed a patent application for thiomersal in 1927;[10] Eli Lilly later marketed the compound under the trade name Merthiolate.[11] In vitro tests conducted by Lilly investigators H. M. Powell and W. A. Jamieson found that it was forty to fifty times as effective as phenol against Staphylococcus aureus.[11] It was used to kill bacteria and prevent contamination in antiseptic ointments, creams, jellies, and sprays used by consumers and in hospitals, including nasal sprays, eye drops, contact lens solutions, immunoglobulins, and vaccines. Thiomersal was used as a preservative (bactericide) so that multidose vials of vaccines could be used instead of single-dose vials, which are more expensive. By 1938, Lilly's assistant director of research listed thiomersal as one of the five most important drugs ever developed by the company.[11] ## Structure Thiomersal features mercury(II) with a coordination number 2, i.e. two ligands are attached to Hg, the thiolate and the ethyl group. The carboxylate group confers solubility in water. Like other two-coordinate Hg(II) compounds, the coordination geometry of Hg is linear, with a 180° S-Hg-C angle. Typically, organomercury thiolate compounds are prepared from organomercury chlorides.[1] ## Uses Thiomersal's main use is as an antiseptic and antifungal agent, due to the oligodynamic effect. In multidose injectable drug delivery systems, it prevents serious adverse effects such as the Staphylococcus infection that, in one 1928 incident, killed 12 of 21 children vaccinated with a diphtheria vaccine that lacked a preservative.[12] Unlike other vaccine preservatives used at the time, thiomersal does not reduce the potency of the vaccines that it protects.[11][clarification needed] Bacteriostatics such as thiomersal are not needed in single-dose injectables.[13] In the United States, countries in the European Union, and a few other affluent countries, thiomersal is no longer used as a preservative in routine childhood vaccination schedules.[9] In the U.S., the only exceptions among vaccines routinely recommended for children are some formulations of the inactivated influenza vaccine for children older than two years.[14] Several vaccines that are not routinely recommended for young children do contain thiomersal, including DT (diphtheria and tetanus), Td (tetanus and diphtheria), and TT (tetanus toxoid); other vaccines may contain a trace of thiomersal from steps in manufacture.[12] The multi-dose versions of the influenza vaccines Fluvirin and Fluzone can contain up to 25 micrograms of mercury per dose from thiomersal.[15][16] Also, four rarely used treatments for pit viper, coral snake, and black widow venom still contain thiomersal.[17] Outside North America and Europe, many vaccines contain thiomersal; the World Health Organization has concluded that there is no evidence of toxicity from thiomersal in vaccines and no reason on safety grounds to change to more expensive single-dose administration.[18] The United Nations Environment Program backed away from an earlier proposal of putting thiomersal, when used as a component in vaccines, on the list of banned compounds, in its campaign to reduce exposure to mercury worldwide.[19] Citing that eliminating the preservative in multi-dose vaccines, primarily used in developing countries, would lead to high cost and a requirement for refrigeration which the developing countries can ill afford, the UN's final decision at the Minamata Convention on Mercury in 2013 was to exclude thiomersal from the treaty.[20] ## Toxicology ### General toxicity Thiomersal is very toxic by inhalation, ingestion, and in contact with skin (EC hazard symbol T+), with a danger of cumulative effects. It is also very toxic to aquatic organisms and may cause long-term adverse effects in aquatic environments (EC hazard symbol N).[21] In the body, it is metabolized or degraded to ethylmercury (C2H5Hg+) and thiosalicylate.[12] Cases have been reported of severe mercury poisoning by accidental exposure or attempted suicide, with some fatalities.[22] Animal experiments suggest that thiomersal rapidly dissociates to release ethylmercury after injection; that the disposition patterns of mercury are similar to those after exposure to equivalent doses of ethylmercury chloride; and that the central nervous system and the kidneys are targets, with lack of motor coordination being a common sign. Similar signs and symptoms have been observed in accidental human poisonings. The mechanisms of toxic action are unknown.[22] Fecal excretion accounts for most of the elimination from the body. Ethylmercury clears from blood with a half-life of about 18 days in adults by breakdown into other chemicals, including inorganic mercury.[23] Ethylmercury is eliminated from the brain in about 14 days in infant monkeys. Risk assessment for effects on the nervous system have been made by extrapolating from dose-response relationships for methylmercury.[24] Methylmercury and ethylmercury distribute to all body tissues, crossing the blood–brain barrier and the placental barrier, and ethylmercury also moves freely throughout the body.[25] Concerns based on extrapolations from methylmercury caused thiomersal to be removed from U.S. childhood vaccines, starting in 1999. Since then, it has been found that ethylmercury is eliminated from the body and the brain significantly faster than methylmercury, so the late-1990s risk assessments turned out to be overly conservative.[24] Though inorganic mercury metabolized from ethylmercury has a much longer half-life in the brain, at least 120 days, it appears to be much less toxic than the inorganic mercury produced from mercury vapor, for reasons not yet understood.[24] ### As an allergen Patch test Thiomersal is used in patch testing for people who have dermatitis, conjunctivitis, and other potentially allergic reactions. A 2007 study in Norway found that 1.9% of adults had a positive patch test reaction to thiomersal;[26] a higher prevalence of contact allergy (up to 6.6%) was observed in German populations.[27] Thiomersal-sensitive individuals can receive intramuscular rather than subcutaneous immunization,[28] though there have been no large sample sized studies regarding this matter to date. In real-world practice on vaccination of adult populations, contact allergy does not seem to elicit clinical reaction.[27] Thiomersal allergy has decreased in Denmark, probably because of its exclusion from vaccines there.[29] In a recent study of Polish children and adolescents with chronic/recurrent eczema, positive reactions to thiomersal were found in 11.7% of children (7–8 y.o.) and 37.6% of adolescents (16–17 y.o.). This difference in the sensitization rates can be explained by changing exposure patterns: The adolescents have received six thiomersal-preserved vaccines during their life course, with the last immunization taking place 2–3 years before the mentioned study, younger children received only four thiomersal-preserved vaccines, with the last one applied five years before the study, while further immunizations were performed with new thiomersal-free vaccines.[30] ### Disproven autism hypothesis Main page: Unsolved:Thiomersal and vaccines Following a review of mercury-containing food and drugs mandated in 1999, the Centers for Disease Control and Prevention (CDC) and the American Academy of Pediatrics asked vaccine manufacturers to remove thiomersal from vaccines as a purely precautionary measure, and it was rapidly phased out of most U.S. and European vaccines.[11][31] Many parents saw the action to remove thiomersal—in the setting of a perceived increasing rate of autism as well as increasing number of vaccines in the childhood vaccination schedule—as indicating that the preservative was the cause of autism.[11] The scientific consensus is that there is no evidence supporting these claims, and the rate of autism continues to climb despite elimination of thiomersal from routine childhood vaccines.[7][32][33][34] Major scientific and medical bodies such as the Institute of Medicine[34] and World Health Organization,[35][36] as well as governmental agencies such as the Food and Drug Administration[12] and the CDC[37] reject any role for thiomersal in autism or other neurodevelopmental disorders.[38] This controversy has caused harm due to parents attempting to treat their autistic children with unproven and possibly dangerous treatments, discouraging parents from vaccinating their children due to fears about thiomersal toxicity,[39] and diverting resources away from research into more promising areas for the cause of autism.[40] Thousands of lawsuits have been filed in a U.S. federal court to seek damages from alleged toxicity from vaccines, including those purportedly caused by thiomersal.[41] ## See also * Chemistry:Nitromersol - Organomercury antiseptic and antifungal agent, a related antimicrobial * Phenylmercuric nitrate \- an organomercury compound with powerful antiseptic and antifungal effects ## References 1. ↑ 1.0 1.1 Melnick, J. G.; Yurkerwich, K.; Buccella, D.; Sattler, W.; Parkin, G. (2008). "Molecular Structures of Thimerosal (Merthiolate) and Other Arylthiolate Mercury Alkyl Compounds". Inorg. Chem. 47 (14): 6421–26. doi:10.1021/ic8005426. PMID 18533648. 2. ↑ "Thimerosal T5125". https://www.sigmaaldrich.com/catalog/product/sigma/t5125?lang=en®ion=US. 3. ↑ Chambers, Michael. "ChemIDplus – 54-64-8 – RTKIYNMVFMVABJ-UHFFFAOYSA-L – Thimerosal [USP:JAN – Similar structures search, synonyms, formulas, resource links, and other chemical information."]. http://chem.sis.nlm.nih.gov/chemidplus/rn/54-64-8. 4. ↑ Sharpe, M. A.; Livingston, A. D.; Baskin, D. S. (2012). "Thimerosal-Derived Ethylmercury is a Mitochondrial Toxin in Human Astrocytes: Possible Role of Fenton Chemistry in the Oxidation and Breakage of mtDNA". Journal of Toxicology 2012: 1–12. doi:10.1155/2012/373678. PMID 22811707. ""...widely used in medical products, including as a preservative in vaccines, immunoglobulin preparations, skin test antigens, antivenins, ophthalmic and nasal products, and tattoo inks..."". 5. ↑ Immunization Safety Review Committee, Board on Health Promotion and Disease Prevention, Institute of Medicine (2004). Immunization Safety Review: Vaccines and Autism. Washington, DC: The National Academies Press. ISBN 978-0-309-09237-1. 6. ↑ Doja, Asif; Roberts, Wendy (November 2006). "Immunizations and autism: a review of the literature". Can J Neurol Sci 33 (4): 341–46. doi:10.1017/s031716710000528x. PMID 17168158. 7. ↑ 7.0 7.1 "Vaccines Do Not Cause Autism". https://www.cdc.gov/vaccinesafety/concerns/autism.html. 8. ↑ Gołoś, A; Lutyńska, A (2015). "Thiomersal-containing vaccines - a review of the current state of knowledge". Przeglad Epidemiologiczny 69 (1): 59–64, 157–61. PMID 25862449. 9. ↑ 9.0 9.1 Bigham, M; Copes, R (2005). "Thiomersal in vaccines: balancing the risk of adverse effects with the risk of vaccine-preventable disease". Drug Saf 28 (2): 89–101. doi:10.2165/00002018-200528020-00001. PMID 15691220. 10. ↑ U.S. Patent 1,672,615 "Alkyl mercuric sulphur compound and process of producing it". 11. ↑ 11.0 11.1 11.2 11.3 11.4 11.5 Baker, JP (2008). "Mercury, Vaccines, and Autism: One Controversy, Three Histories". Am J Public Health 98 (2): 244–53. doi:10.2105/AJPH.2007.113159. PMID 18172138. 12. ↑ 12.0 12.1 12.2 12.3 "Thimerosal in vaccines". Center for Biologics Evaluation and Research, U.S. Food and Drug Administration. June 3, 2008. https://www.fda.gov/cber/vaccine/thimerosal.htm. 13. ↑ "Thimerosal in Vaccines: Frequently Asked Questions". Food and Drug Administration. https://www.fda.gov/cber/vaccine/thimfaq.htm. 14. ↑ Coordinating Center for Infectious Diseases (October 26, 2007). "Thimerosal in seasonal influenza vaccine". Centers for Disease Control and Prevention. http://cdc.gov/FLU/ABOUT/QA/thimerosal.htm. 15. ↑ "Seasonal Influenza Vaccine Supply for the U.S. 2016-2017 Influenza Season | Seasonal Influenza (Flu) | CDC". https://www.cdc.gov/flu/about/qa/vaxsupply.htm. 16. ↑ Grohskopf, Lisa A.; Sokolow, Leslie Z.; Broder, Karen R.; Olsen, Sonja J.; Karron, Ruth A.; Jernigan, Daniel B.; Bresee, Joseph S. (2016). "Prevention and Control of Seasonal Influenza with Vaccines". MMWR. Recommendations and Reports 65 (5): 1–54. doi:10.15585/mmwr.rr6505a1. ISSN 1057-5987. PMID 27560619. https://www.cdc.gov/mmwr/volumes/65/rr/rr6505a1.htm. 17. ↑ "Mercury in plasma-derived products". U.S. Food and Drug Administration. September 9, 2004. https://www.fda.gov/cber/blood/mercplasma.htm. 18. ↑ Global Advisory Committee on Vaccine Safety (July 14, 2006). "Thiomersal and vaccines". World Health Organization. https://www.who.int/vaccine_safety/topics/thiomersal/en/index.html. 19. ↑ Hamilton, Jon (17 December 2012). "Doctors Argue Against Proposed Ban on Vaccine Preservative". NPR. https://www.npr.org/blogs/health/2012/12/17/167280941/experts-argue-against-proposed-ban-on-vaccine-preservative. 20. ↑ Sulaski Wyckoff, Alyson (January 22, 2013). "Global ban on mercury grants exception to thimerosal-containing vaccines". AAP News (American Academy of Pediatrics). https://www.aappublications.org/content/early/2013/01/22/aapnews.20130122-1. Retrieved August 24, 2019. 21. ↑ "Safety data sheet, Thiomersal Ph Eur, BP, USP". Merck. June 12, 2005. http://www.merck-chemicals.com/documents/sds/emd/int/en/8170/817043.pdf. 22. ↑ 22.0 22.1 Clarkson, TW (2002). "The three modern faces of mercury". Environ Health Perspect 110 (S1): 11–23. doi:10.1289/ehp.02110s111. PMID 11834460. PMC 1241144. http://www.ehponline.org/members/2002/suppl-1/11-23clarkson/clarkson-full.html. 23. ↑ Magos, L. (2003). "Neurotoxic character of thimerosal and the allometric extrapolation of adult clearance half-time to infants". Journal of Applied Toxicology 23 (4): 263–269. doi:10.1002/jat.918. PMID 12884410. https://pubmed.ncbi.nlm.nih.gov/12884410/. Retrieved 2021-01-19. 24. ↑ 24.0 24.1 24.2 Clarkson, TW; Magos, L (2006). "The toxicology of mercury and its chemical compounds". Crit Rev Toxicol 36 (8): 609–62. doi:10.1080/10408440600845619. PMID 16973445. 25. ↑ Clarkson, TW; Vyas, JB; Ballatori, N (2007). "Mechanisms of mercury disposition in the body". Am J Ind Med 50 (10): 757–64. doi:10.1002/ajim.20476. PMID 17477364. 26. ↑ Dotterud, LK; Smith-Sivertsen, T (2007). "Allergic contact sensitization in the general adult population: a population-based study from Northern Norway". Contact Dermatitis 56 (1): 10–15. doi:10.1111/j.1600-0536.2007.00980.x. PMID 17177703. 27. ↑ 27.0 27.1 Uter, W; Ludwig, A; Balda, BR (2004). "The prevalence of contact allergy differed between population-based and clinic-based data". J Clin Epidemiol 57 (6): 627–32. doi:10.1016/j.jclinepi.2003.04.002. PMID 15246132. 28. ↑ Aberer, W (1991). "Vaccination despite thimerosal sensitivity". Contact Dermatitis 24 (1): 6–10. doi:10.1111/j.1600-0536.1991.tb01621.x. PMID 2044374. 29. ↑ Thyssen, JP; Linneberg, A; Menné, T; Johansen, JD (2007). "The epidemiology of contact allergy in the general population – prevalence and main findings". Contact Dermatitis 57 (5): 287–99. doi:10.1111/j.1600-0536.2007.01220.x. PMID 17937743. 30. ↑ Czarnobilska, E; Obtulowicz, K; Dyga, W; Spiewak, R (2011). "The most important contact sensitizers in Polish children and adolescents with atopy and chronic recurrent eczema as detected with the extended European Baseline Series". Pediatr Allergy Immunol 22 (2): 252–56. doi:10.1111/j.1399-3038.2010.01075.x. PMID 20969635. 31. ↑ "Thimerosal in vaccines: frequently asked questions (FAQs)". Center for Biologics Evaluation and Research, U.S. Food and Drug Administration. June 7, 2007. https://www.fda.gov/cber/vaccine/thimfaq.htm. 32. ↑ DeStefano, F (2007). "Vaccines and autism: evidence does not support a causal association". Clin Pharmacol Ther 82 (6): 756–59. doi:10.1038/sj.clpt.6100407. PMID 17928818. 33. ↑ Doja, A; Roberts, W (2006). "Immunizations and autism: a review of the literature". Can J Neurol Sci 33 (4): 341–46. doi:10.1017/s031716710000528x. PMID 17168158. 34. ↑ 34.0 34.1 Immunization Safety Review Committee, Board on Health Promotion and Disease Prevention, Institute of Medicine (2004). Immunization Safety Review: Vaccines and Autism. Washington, DC: The National Academies Press. ISBN 978-0-309-09237-1. http://www.nap.edu/catalog/10997.html. 35. ↑ World Health Organization (2006). "Thiomersal and vaccines: questions and answers". http://who.int/vaccine_safety/topics/thiomersal/questions/en/. 36. ↑ WHO. "Statement on thiomersal". https://www.who.int/vaccine_safety/committee/topics/thiomersal/statement_jul2006/en. 37. ↑ Centers for Disease Control (February 8, 2008). "Mercury and vaccines (thimerosal)". https://www.cdc.gov/vaccinesafety/updates/thimerosal.htm. 38. ↑ Sugarman, SD (2007). "Cases in vaccine court – legal battles over vaccines and autism". N Engl J Med 357 (13): 1275–77. doi:10.1056/NEJMp078168. PMID 17898095. http://content.nejm.org/cgi/content/full/357/13/1275. 39. ↑ Harris, G; O'Connor, A (June 25, 2005). "On autism's cause, it's parents vs. research". New York Times. https://www.nytimes.com/2005/06/25/science/on-autisms-cause-its-parents-vs-research.html. 40. ↑ Offit, PA (2007). "Thimerosal and vaccines – a cautionary tale". N Engl J Med 357 (13): 1278–79. doi:10.1056/NEJMp078187. PMID 17898096. http://content.nejm.org/cgi/content/full/357/13/1278. 41. ↑ Autism cases in vaccine court: * Sugarman, SD (2007). "Cases in vaccine court – legal battles over vaccines and autism". N Engl J Med 357 (13): 1275–77. doi:10.1056/NEJMp078168. PMID 17898095. http://content.nejm.org/cgi/content/full/357/13/1275. * U.S. Court of Federal Claims (September 28, 2007). "Vaccine Program/Office of Special Masters Omnibus Autism Proceeding". http://www.uscfc.uscourts.gov/OSM/OSMAutism.htm. * v * t * e Mercury compounds Mercury(I)| * HgH * Hg2H2 * Hg2Br2 * Hg2Cl2 * Hg2F2 * Hg2I2 * Hg2(NO3)2 * Hg2O * Hg2CO3 * Hg2SO4 Mercury(II)| * HgH2 * HgNH2Cl * HgSe * HgS * HgTe * Hg(O2CCH3)2 * HgBr2 * HgCl2 * Hg(CN)2 * HgF2 * Hg(OH)2 * HgI2 * Hg(NO3)2 * HgO * HgSO4 * Hg(SCN)2 * Hg(CNO)2 * Hg3N2 * Hg(Si(CH3)3)2 * K2HgI4 | Organomercury compounds| * Hg(CH3)2 * Hg(C2H5)2 * Hg(C6H5)2 * HgC6H5CH3CO2 * HgC6H5OB(OH)2 * HgC6H5NO3 * HgC6H5CCl3 * HgClC6H4CO2H * HgOHCH2CHOCH3CH2(NHCO)2C2H4CO2H * HgOHCH2CHOCH3CH2NHCOC6H4OCH2CO2H * Na2HgOHC6HOBrC6H2OBrOCHC6H4CO2 * HgOC6H2CH3NO2 * NaHgC2H5SC6H4CO2 | Mercury(IV)| * HgF4 (hypothetical) Amalgams| * Na(Hg) * Al(Hg) * K(Hg) * Au(Hg) * Tl(Hg) * Sn(Hg) Mercury cations| * Hg2+ * Hg22+ * Hg32+ * Hg42+ * Hg34+ * HgCH3+ * HgC2H5+ * HgC6H5+ * v * t * e Artificial induction of immunity / Immunization: Vaccines, Vaccination, Infection, Biology:Inoculat, Inoculation (J07) Development| * Adjuvants * List of vaccine ingredients * Mathematical modelling * Timeline * Trials Classes| * Conjugate vaccine * DNA vaccination * Inactivated vaccine * Live vector vaccine * Attenuated vaccine * Heterologous vaccine * Subunit/component / Peptide / Virus-like particle * Toxoid Administration| * Global: * GAVI Alliance * Policy * Schedule * Vaccine injury * USA: * ACIP * Vaccine court * Vaccines for Children Program * VAERS * VSD Vaccines| | Bacterial| * Anthrax * Brucellosis * Cholera# * Diphtheria# * Hib# * Leptospirosis * Lyme disease‡ * Meningococcus# * MeNZB * Medicine:NmVac4-A/C/Y/W-135 * Pertussis# * Plague * Pneumococcal# * PCV * PPSV * Q fever * Tetanus# * Tuberculosis * BCG# * Typhoid# * Ty21a * ViCPS * Typhus * combination: DTwP/DTaP | Viral| * Adenovirus * Flu# * H1N1 (Pandemrix) * LAIV * Hantavirus * Hepatitis A# * Hepatitis B# * Hepatitis E * HPV * Cervarix * Gardasil * Japanese encephalitis# * Measles# * Mumps# * Medicine:Mumpsvax * Polio# * Sabin * Salk * Rabies# * Rotavirus# * Rubella# * Smallpox * Medicine:Dryvax * Tick-borne encephalitis * Varicella zoster * chicken pox# * Zoster vaccine * Yellow fever# * combination: * MMR * MMRV * research: * Chikungunya * Cytomegalovirus * Dengue * Ebola * Epstein–Barr virus * Hepatitis C * HIV Protozoan| * Malaria * RTS,S * research: * Trypanosomiasis Helminthiasis| * research: * Hookworm * Schistosomiasis Other| * Androvax (androstenedione albumin) * Cancer vaccines * ALVAC-CEA * BCG# * Hepatitis B# * HPV * Cervarix * Gardasil * PROSTVAC * NicVAX * Ovandrotone albumin (Fecundin) * TA-CD * TA-NIC * combination * DTaP-IPV/Hib * DTaP-IPV-HepB * Hexavalent vaccine * Pentavalent vaccine Controversy| * General * MMR * NCVIA * Pox party * Thiomersal * Vaccines and SIDS * Lancet MMR autism fraud * Cedillo v. Secretary of Health and Human Services * Alternative vaccination schedule Related| * Epidemiology * Eradication of infectious diseases * Every Child by Two * List of vaccine topics * #WHO-EM * ‡Withdrawn from market * Clinical trials: * †Phase III * §Never to phase III * v * t * e Antiseptics and disinfectants (D08) Acridine derivatives| * Ethacridine lactate * 9-Aminoacridine * Euflavine Biguanides and amidines| * Dibrompropamidine * Chlorhexidine# * Propamidine * Hexamidine * Polihexanide Phenol and derivatives| * Hexachlorophene * Policresulen * Phenol * Triclosan * Triclocarban * Chloroxylenol# * Biphenylol * Fenticlor Nitrofuran derivatives| * Nitrofurazone Iodine products| * Iodine/octylphenoxypolyglycolether * Povidone-iodine# * Diiodohydroxypropane Quinoline derivatives| * Dequalinium * Chlorquinaldol * Oxyquinoline * Clioquinol Quaternary ammonium compounds| * Benzalkonium * Benzethonium chloride * Cetrimonium (bromide/chloride) * Cetylpyridinium * Cetrimide * Benzoxonium chloride * Didecyldimethylammonium chloride Mercurial products| * Mercuric amidochloride * Phenylmercuric borate * Mercuric chloride * Merbromin * Thiomersal * Mercuric iodide Silver compounds| * Silver nitrate Alcohols| * Propanol (propyl alcohol) * Isopropanol (isopropyl alcohol) * Ethanol (ethyl alcohol)# Other| * Potassium permanganate * Sodium hypochlorite * Halazone * Monalazone * Hydrogen peroxide * Eosin * Chloramine-T (tosylchloramide) * Octenidine dihydrochloride * #WHO-EM * ‡Withdrawn from market * Clinical trials: * †Phase III * §Never to phase III * v * t * e Sodium compounds * NaAlO2 * NaBH4 * NaBH3(CN) * NaBO2 * NaBiO3 * NaBr * NaBrO * NaBrO3 * NaCH3COO * NaC6H5CO2 * NaC6H4(OH)CO2 * NaCN * NaCl * NaClO * NaClO2 * NaClO3 * NaClO4 * NaF * Na2FeO4 * NaH * NaHCO3 * NaH2PO4 * NaHSO3 * NaHSO4 * NaI * NaIO3 * NaIO4 * Na5IO6 * NaMnO4 * NaN3 * NaNH2 * NaNO2 * NaNO3 * NaOCN * NaO2 * NaO3 * NaOH * NaPO2H2 * NaReO4 * NaSCN * NaSH * NaTcO4 * NaVO3 * Na2CO3 * Na2C2O4 * Na2CrO4 * Na2Cr2O7 * Na2GeO3 * Na2MnO4 * Na3MnO4 * Na2MoO4 * Na2MoS4 * Na2N2O2 * Na2O * Na2O2 * Na2O(UO3)2 * Na2PO3F * Na2S * Na2SO3 * Na2SO4 * Na2S2O3 * Na2S2O4 * Na2S2O5 * Na2S2O6 * Na2S2O7 * Na2S2O8 * Na2S4O6 * Na2Se * Na2SeO3 * Na2SeO4 * Na2SiO3 * Na2Si2O5 * Na4SiO4 * Na2Te * Na2TeO3 * Na2TeO4 * Na2Po * Na2Ti3O7 * Na2U2O7 * Na2WO4 * Na2Zn(OH)4 * Na3N * Na3P * Na3PO4 * Na3VO4 * Na4Fe(CN)6 * Na4P3O7 * Na5P3O10 Chemical formulas 0.00 (0 votes) Original source: https://en.wikipedia.org/wiki/Thiomersal. Read more | Retrieved from "https://handwiki.org/wiki/index.php?title=Chemistry:Thiomersal&oldid=2206129" *[CID]: Compound ID *[H300]: Fatal if swallowed *[H310]: Fatal in contact with skin *[H330]: Fatal if inhaled *[H373]: May cause damage to organs through prolonged or repeated exposure *[H410]: Very toxic to aquatic life with long lasting effects *[P260]: Do not breathe dust/fume/gas/mist/vapours/spray *[P273]: Avoid release to the environment *[P280]: Wear protective gloves/protective clothing/eye protection/face protection *[P301]: IF SWALLOWED: *[P310]: Immediately call a POISON CENTER or doctor/physician *[P330]: Rinse mouth *[P302]: IF ON SKIN: *[P352]: Wash with soap and water *[P304]: IF INHALED: *[P340]: Remove victim to fresh air and keep at rest in a position comfortable for breathing *[v]: View this template *[t]: Discuss this template *[e]: Edit this template