Short description: Chemical compound 7-Hydroxymitragynine Names Preferred IUPAC name Methyl (2E)-2-[(2S,3S,7aS,12bS)-3-ethyl-7a-hydroxy-8-methoxy-1,2,3,4,6,7,7a,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate Other names 7α-Hydroxy-7H-mitragynine;[1] 9-Methoxycorynantheidine hydroxyindolenine[1] Identifiers CAS Number * 174418-82-7 N 3D model (JSmol) * Interactive image * Interactive image ChEMBL | * ChEMBL61630 Y ChemSpider | * 23152144 Y PubChem CID * 44301524 UNII | * 2T3TWA75R0 N InChI * InChI=1S/C23H30N2O5/c1-5-14-12-25-10-9-23(27)20-17(7-6-8-19(20)29-3)24-21(23)18(25)11-15(14)16(13-28-2)22(26)30-4/h6-8,13-15,18,27H,5,9-12H2,1-4H3/b16-13+/t14-,15+,18+,23+/m1/s1 Y Key: RYENLSMHLCNXJT-CYXFISRXSA-N Y SMILES * CC[C@@H]1CN2CC[C@@]3(O)C(=Nc4cccc(OC)c34)[C@@H]2C[C@@H]1\C(=C/OC)C(=O)OC * CC[C@@H]1CN2CC[C@@]3(O)C(=NC4=CC=CC(OC)=C34)[C@@H]2C[C@@H]1\C(=C/OC)C(=O)OC Properties Chemical formula | C23H30N2O5 Molar mass | 414.502 g·mol−1 log P | 1.266 Acidity (pKa) | 12.203 Basicity (pKb) | 1.794 Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). N verify (what is YN ?) Infobox references 7-Hydroxymitragynine is a terpenoid indole alkaloid from the plant Mitragyna speciosa, commonly known as Kratom.[2] It is often referred to as ‘7-OH’. It was first described in 1994[3] and is a natural product derived from the mitragynine present in the Kratom leaf. It is considered an oxidized derivative and active metabolite of mitragynine.[4] 7-Acetoxymitragynine ## Contents * 1 Metabolism * 2 See also * 3 References * 4 External links ## Metabolism After a kratom study, it was revealed that 7-OH converts into Mitragynine pseudoindoxyl.[5] Mitragynine Pseudoindoxyl Mitragyna speciosa alkaloids at opioid receptors Compound | Affinities (Ki) | Ratio | Ref | | | MOR | DOR | KOR | MOR:DOR:KOR 7-Hydroxymitragynine | 13.5 | 155 | 123 | 1:11:9 | [6] Mitragynine | 7.24 | 60.3 | 1,100 | 1:8:152 | [6] Mitragynine pseudoindoxyl | 0.087 | 3.02 | 79.4 | 1:35:913 | [6] ## See also * Ajmalicine * Mitragynine * Mitragynine pseudoindoxyl * Mitraphylline * β-Prodine \- molecule overlaying 7-hydroxymitragynine's opioid QSAR (Quantitative structure-activity relationship) ## References 1. ↑ 1.0 1.1 Chemical Abstracts Service: Columbus, OH, 2004; RN 174418-82-7 (accessed via SciFinder Scholar, version 2007.3; November 30, 2011) 2. ↑ "Antinociceptive effect of 7-hydroxymitragynine in mice: Discovery of an orally active opioid analgesic from the Thai medicinal herb Mitragyna speciosa". Life Sciences 74 (17): 2143–55. March 2004. doi:10.1016/j.lfs.2003.09.054. PMID 14969718. 3. ↑ Ponglux, Dhavadee; Wongseripipatana, Sumphan; Takayama, Hiromitsu; Kikuchi, Masae; Kurihara, Mika; Kitajima, Mariko; Aimi, Norio; Sakai, Shin-ichiro (1994). "A New Indole Alkaloid, 7 α-Hydroxy-7H-mitragynine, from Mitragyna speciosa in Thailand" (in en). Planta Medica 60 (6): 580–581. doi:10.1055/s-2006-959578. ISSN 0032-0943. PMID 17236085. https://www.thieme-connect.de/products/ejournals/abstract/10.1055/s-2006-959578. 4. ↑ "7-Hydroxymitragynine - Green Leaf Kratom - Kratom Blogs Archives" (in en-US). 2020-08-19. https://www.greenleafkratom.com/7-hydroxymitragynine/. 5. ↑ "Mitragynine/Corynantheidine Pseudoindoxyls As Opioid Analgesics with Mu Agonism and Delta Antagonism, Which Do Not Recruit β-Arrestin-2". J. Med. Chem. 59 (18): 8381–97. 2016. doi:10.1021/acs.jmedchem.6b00748. PMID 27556704. 6. ↑ 6.0 6.1 6.2 "Studies on the synthesis and opioid agonistic activities of mitragynine-related indole alkaloids: discovery of opioid agonists structurally different from other opioid ligands". J. Med. Chem. 45 (9): 1949–56. 2002. doi:10.1021/jm010576e. PMID 11960505. ## External links * "Chemistry and pharmacology of analgesic indole alkaloids from the rubiaceous plant, Mitragyna speciosa" (pdf). Chemical & Pharmaceutical Bulletin 52 (8): 916–28. August 2004. doi:10.1248/cpb.52.916. PMID 15304982. https://www.jstage.jst.go.jp/article/cpb/52/8/52_8_916/_pdf. \- synthesis of 7-hydroxymitragynine from mitragynine * v * t * e Opioid receptor modulators MOR| * Agonists (abridged; see here for a full list): 3-HO-PCP * 7-Acetoxymitragynine * 7-Hydroxymitragynine * ψ-Akuammigine * α-Chlornaltrexamine * α-Narcotine * Acetyldihydrocodeine * Acetylfentanyl * Acrylfentanyl * Adrenorphin (metorphamide) * AH-7921 * Akuammicine * Akuammidine * Alfentanil * Anileridine * Apparicine * β-Endorphin * BAM-12P * BAM-18P * BAM-22P * Benzhydrocodone * Benzylmorphine * Bezitramide * Biphalin * BU08070 * Buprenorphine * Butorphan * Butorphanol * Butyrfentanyl * BW373U86 * Carfentanil * Casokefamide * Cebranopadol * Chloroxymorphamine * Codeine * DADLE * DAMGO (DAGO) * Dermorphin * Desmetramadol (desmethyltramadol) * Desomorphine * Dextromoramide * Dextropropoxyphene (propoxyphene) * Dezocine * Dimenoxadol * Dimethylaminopivalophenone * Eluxadoline * Diamorphine (heroin) * Dihydrocodeine * Dihydroetorphine * Dihydromorphine * Dinalbuphine sebacate * Diphenoxylate * Dipipanone * Dynorphin A * Embutramide * Endomorphin-1 * Endomorphin-2 * Eseroline * Ethylmorphine * Etorphine * Fentanyl * Fluorophen * Frakefamide * Furanylfentanyl * Hemorphin-4 * Herkinorin * Hodgkinsine * Hydrocodone * Hydromorphinol * Hydromorphone * IBNtxA * Ketamine * Ketobemidone * Kratom * Laudanosine * Lefetamine * Leu-enkephalin * Levacetylmethadol * Levomethorphan * Levorphanol * Lexanopadol * Loperamide * Loxicodegol * Matrine * Meptazinol * Met-enkephalin (metenkefalin) * Methadone * Metkefamide * Metopon * Mitragynine * Mitragynine pseudoindoxyl * Morphiceptin * Morphine * Nalbuphine * NalBzOH * Nalmexone * Naltalimide * Neopine * NFEPP * Nicocodeine * Nicodicodine * Nicomorphine * NKTR-181 * Norketamine * Octreotide * Oliceridine * OM-3-MNZ * Oripavine * Oxycodone * Oxymorphazone * Oxymorphonazine * Oxymorphone * Oxymorphone phenylhydrazone * OxyPNPH * Papaver somniferum (opium) * Pentazocine * Pericine * Pethidine (meperidine) * Phenazocine * Phencyclidine * Piminodine * Piritramide * PL-017 * Prodine * Propiram * PZM21 * Racemethorphan * Racemorphan * Remifentanil * Salsolinol * SC-17599 * Sinomenine * Sufentanil * Tapentadol * Tetrahydropapaveroline * TH-030418 * Thebaine * Thienorphine * Tianeptine * Tilidine * Tramadol * Trimebutine * TRIMU 5 * TRV734 * Tubotaiwine * U-47700 * Valorphin * Viminol * Xorphanol * PAMs: BMS-986121 * BMS-986122 * Antagonists: (3S,4S)-Picenadol * 2-(S)-N,N-(R)-Viminol * 3CS-nalmefene * 4-Caffeoyl-1,5-quinide * 4′-Hydroxyflavanone * 4',7-Dihydroxyflavone * 6β-Naltrexol * 6β-Naltrexol-d4 * 18-MC * α-Gliadin * β-Chlornaltrexamine * β-Funaltrexamine * Akuammine * Alvimopan * AM-251 * Apigenin * AT-076 * Axelopran * Bevenopran * Catechin * Catechin gallate * Clocinnamox * CTAP * CTOP * Cyclofoxy * Cyprodime * Diacetylnalorphine * Diprenorphine * ECG * EGC * Epicatechin * Eptazocine * Gemazocine * Ginsenoside R * Hyperoside * Ibogaine * Levallorphan * Lobeline * LY-255582 * LY-2196044 * Methocinnamox * Methylnaltrexone * Methylsamidorphan chloride * Naldemedine * Nalmefene * Nalodeine (N-allylnorcodeine) * Nalorphine * Nalorphine dinicotinate * Naloxazone * Naloxegol * Naloxol * Naloxonazine * Naloxone * Naltrexazone * Naltrexonazine * Naltrexone * Naltrindole * Naringenin * Noribogaine * Oxilorphan * Pawhuskin A * Rimonabant * Quadazocine * Samidorphan * Taxifolin * Unknown/unsorted: Cannabidiol * Coronaridine * Cyproterone acetate * Dihydroakuuamine * Tabernanthine * Tetrahydrocannabinol DOR| * Agonists: 3CS-nalmefene * 6'-GNTI * 7-SIOM * ADL-5747 (PF-04856881) * ADL-5859 * Alazocine (SKF-10047) * Amoxapine * AR-M100390 (ARM390) * AZD2327 * β-Endorphin * BAM-18P * Biphalin * BU-48 * Butorphan * Butorphanol * BW373U86 * Casokefamide * Cebranopadol * Codeine * Cyclazocine * DADLE * Deltorphin A * Deltorphin I * Deltorphin II * Desmethylclozapine * Desmetramadol (desmethyltramadol) * Dezocine * Diamorphine (heroin) * Dihydroetorphine * Dihydromorphine * DPDPE * DPI-221 * DPI-3290 * DSLET * Ethylketazocine * Etorphine * Fentanyl * FIT * Fluorophen * Hemorphin-4 * Hydrocodone * Hydromorphone * Ibogaine * Isomethadone * JNJ-20788560 * KNT-127 * Kratom * Laudanosine * Leu-enkephalin * Levomethorphan * Levorphanol * Lexanopadol * Lofentanil * Met-enkephalin (metenkefalin) * Metazocine * Metkefamide * Mitragynine * Mitragynine pseudoindoxyl * Morphine * N-Phenethyl-14-ethoxymetopon * Norbuprenorphine * NalBzOH * Oripavine * Oxycodone * Oxymorphone * Pethidine (meperidine) * Proglumide * Racemethorphan * Racemorphan * RWJ-394674 * Samidorphan * SB-235863 * SNC-80 * SNC-162 * TAN-67 (SB-205,607) * TH-030418 * Thebaine * Thiobromadol (C-8813) * Tonazocine * Tramadol * TRV250 * Xorphanol * Zenazocine * Antagonists: 4',7-Dihydroxyflavone * 5'-NTII * 6β-Naltrexol * 6β-Naltrexol-d4 * α-Santolol * β-Chlornaltrexamine * Apigenin * AT-076 * Axelopran * Bevenopran * BNTX * Catechin * Catechin gallate * Clocinnamox * Diacetylnalorphine * Diprenorphine * ECG * EGC * Eluxadoline * Epicatechin * ICI-154129 * ICI-174864 * LY-255582 * LY-2196044 * Methylnaltrexone * Methylnaltrindole * N-Benzylnaltrindole * Nalmefene * Nalorphine * Naltrexone * Naltriben * Naltrindole * Naloxone * Naringenin * Noribogaine * Pawhuskin A * Quadazocine * SDM25N * SoRI-9409 * Taxifolin * Thienorphine * Unknown/unsorted: 18-MC * Cannabidiol * Coronaridine * Cyproterone acetate * Tabernanthine * Tetrahydrocannabinol KOR| * Agonists: 3CS-nalmefene * 6'-GNTI * 8-CAC * 18-MC * 14-Methoxymetopon * β-Chlornaltrexamine * β-Funaltrexamine * Adrenorphin (metorphamide) * Akuuamicine * Alazocine (SKF-10047) * Allomatrine * Apadoline * Asimadoline * BAM-12P * BAM-18P * BAM-22P * Big dynorphin * Bremazocine * BRL-52537 * Butorphan * Butorphanol * BW373U86 * Cebranopadol * Ciprefadol * CR665 * Cyclazocine * Cyclorphan * Cyprenorphine * Desmetramadol (desmethyltramadol) * Diamorphine (heroin) * Diacetylnalorphine * Difelikefalin * Dihydroetorphine * Dihydromorphine * Dinalbuphine sebacate * Diprenorphine * Dynorphin A * Dynorphin B (rimorphin) * Eluxadoline * Enadoline * Eptazocine * Erinacine E * Ethylketazocine * Etorphine * Fedotozine * Fentanyl * Gemazocine * GR-89696 * GR-103545 * Hemorphin-4 * Herkinorin * HS665 * Hydromorphone * HZ-2 * Ibogaine * ICI-199,441 * ICI-204,448 * Ketamine * Ketazocine * Laudanosine * Leumorphin (dynorphin B-29) * Levallorphan * Levomethorphan * Levorphanol * Lexanopadol * Lofentanil * LPK-26 * Lufuradom * Matrine * MB-1C-OH * Menthol * Metazocine * Metkefamide * Mianserin * Mirtazapine * Morphine * Moxazocine * MR-2034 * N-MPPP * Nalbuphine * NalBzOH * Nalfurafine * Nalmefene * Nalodeine (N-allylnorcodeine) * Nalorphine * Naltriben * Niravoline * Norbuprenorphine * Norbuprenorphine-3-glucuronide * Noribogaine * Norketamine * Oripavine * Oxilorphan * Oxycodone * Pentazocine * Pethidine (meperidine) * Phenazocine * Proxorphan * Racemethorphan * Racemorphan * RB-64 * Salvinorin A (salvia) * Salvinorin B ethoxymethyl ether * Salvinorin B methoxymethyl ether * Samidorphan * Spiradoline (U-62,066) * TH-030418 * Thienorphine * Tifluadom * Tricyclic antidepressants (e.g., amitriptyline, desipramine, imipramine, nortriptyline) * U-50488 * U-54,494A * U-69,593 * Xorphanol * Antagonists: 4′-Hydroxyflavanone * 4',7-Dihydroxyflavone * 5'-GNTI * 6'-GNTI * 6β-Naltrexol * 6β-Naltrexol-d4 * β-Chlornaltrexamine * Buprenorphine/samidorphan * Amentoflavone * ANTI * Apigenin * Arodyne * AT-076 * Aticaprant * Axelopran * AZ-MTAB * Binaltorphimine * BU09059 * Buprenorphine * Catechin * Catechin gallate * CERC-501 (LY-2456302) * Clocinnamox * Cyclofoxy * Dezocine * DIPPA * EGC * ECG * Epicatechin * Hyperoside * JDTic * LY-255582 * LY-2196044 * LY-2444296 * LY-2459989 * LY-2795050 * MeJDTic * Methylnaltrexone * ML190 * ML350 * MR-2266 * N-Fluoropropyl-JDTic * Naloxone * Naltrexone * Naltrindole * Naringenin * Norbinaltorphimine * Noribogaine * Pawhuskin A * PF-4455242 * RB-64 * Quadazocine * Taxifolin * UPHIT * Zyklophin * Unknown/unsorted: Akuammicine * Akuammine * Coronaridine * Cyproterone acetate * Dihydroakuuamine * Ibogamine * Tabernanthine NOP| * Agonists: (Arg14,Lys15)Nociceptin * ((pF)Phe4)Nociceptin(1-13)NH2 * (Phe1Ψ(CH2-NH)Gly2)Nociceptin(1-13)NH2 * Ac-RYYRWK-NH2 * Ac-RYYRIK-NH2 * BU08070 * Buprenorphine * Cebranopadol * Dihydroetorphine * Etorphine * JNJ-19385899 * Levomethorphan * Levorphanol * Levorphanol * Lexanopadol * MCOPPB * MT-7716 * NNC 63-0532 * Nociceptin (orphanin FQ) * Nociceptin (1-11) * Nociceptin (1-13)NH2 * Norbuprenorphine * Racemethorphan * Racemorphan * Ro64-6198 * Ro65-6570 * SCH-221510 * SCH-486757 * SR-8993 * SR-16435 * TH-030418 * Antagonists: (Nphe1)Nociceptin(1-13)NH2 * AT-076 * BAN-ORL-24 * BTRX-246040 (LY-2940094) * J-113,397 * JTC-801 * NalBzOH * Nociceptin (1-7) * Nocistatin * SB-612,111 * SR-16430 * Thienorphine * Trap-101 * UFP-101 Unsorted| * β-Casomorphins * Amidorphin * BAM-20P * Cytochrophin-4 * Deprolorphin * Gliadorphin (gluteomorphin) * Gluten exorphins * Hemorphins * Kava constituents * MEAGL * MEAP * NEM * Neoendorphins * Nepetalactone (catnip) * Peptide B * Peptide E * Peptide F * Peptide I * Rubiscolins * Soymorphins Others| * Enkephalinase inhibitors: Amastatin * BL-2401 * Candoxatril * D -Phenylalanine * Dexecadotril (retorphan) * Ecadotril (sinorphan) * Kelatorphan * Racecadotril (acetorphan) * RB-101 * RB-120 * RB-3007 * Opiorphan * Selank * Semax * Spinorphin * Thiorphan * Tynorphin * Ubenimex (bestatin) * Propeptides: β-Lipotropin (proendorphin) * Prodynorphin * Proenkephalin * Pronociceptin * Proopiomelanocortin (POMC) * Others: Kyotorphin (met-enkephalin releaser/degradation stabilizer) See also: Receptor/signaling modulators • Signaling peptide/protein receptor modulators 0.00 (0 votes) Original source: https://en.wikipedia.org/wiki/7-Hydroxymitragynine. Read more | Retrieved from "https://handwiki.org/wiki/index.php?title=Chemistry:7-Hydroxymitragynine&oldid=2209966" *[CID]: Compound ID *[Ki]: Inhibitor constant *[MOR]: μ-opioid receptor *[DOR]: δ-opioid receptor *[KOR]: κ-opioid receptor *[v]: View this template *[t]: Discuss this template *[e]: Edit this template *[NOP]: Nociceptin receptor