2,alpha-DMT Identifiers IUPAC name * 1-(2-methyl-1H-indol-3-yl)propan-2-amine CAS Number| * 4966-28-3 ChemSpider| * 23511903 Y Chemical and physical data Formula| C12H16N2 Molar mass| 188.274 g·mol−1 3D model (JSmol)| * Interactive image SMILES * Cc1c(c2ccccc2[nH]1)CC(C)N InChI * InChI=1S/C12H16N2/c1-8(13)7-11-9(2)14-12-6-4-3-5-10(11)12/h3-6,8,14H,7,13H2,1-2H3 Y * Key:AXZQFXRPULJFQK-UHFFFAOYSA-N Y (verify) 2,alpha-DMT, or 2,α-dimethyltryptamine, is a tryptamine and a lesser-known psychedelic drug. It is the 2,a-dimethyl analog of DMT. 2,α-DMT was first synthesized by Alexander Shulgin. In his book TiHKAL (Tryptamines I Have Known and Loved), Shulgin lists the dosage as 300-500 mg, and the duration as 7–10 hours.[1] 2,α-DMT causes mydriasis and paresthesia. It also produces a calm, drunk-like feeling. Very little data exists about the pharmacological properties, metabolism, and toxicity of 2,α-DMT. ## References 1. ↑ Shulgin, Alexander; Shulgin, Ann (September 1997). TiHKAL: The Continuation. Berkeley, California: Transform Press, 422. ISBN 0-9630096-9-9. OCLC 38503252. http://www.erowid.org/library/books_online/tihkal/tihkal.shtml. ## External links * 2,a-DMT Entry in TIHKAL * 2,α-DMT Entry in TiHKAL • info * v * t * e Tryptamines * 1-Methylpsilocin * 2-Methyl-5-HT * 4,5-DHP-DMT * 4,5-MDO-DMT * 4,5-MDO-DiPT * 4-AcO-DALT * 4-AcO-DET * 4-AcO-DMT * 4-AcO-DiPT * 4-AcO-NMT * 4-AcO-MET * 4-AcO-DPT * 4-AcO-MiPT * 4-HO-DALT * 4-HO-DET * 4-HO-DiPT * 4-HO-DPT * 4-HO-DSBT * 4-HO-EPT * 4-HO-MALT * 4-HO-MET * 4-HO-McPT * 4-HO-McPeT * 4-HO-MiPT * 4-HO-MPT * 4-HO-NMT * 4-HO-αMT * 4-Me-αET * 4-Me-αMT * 4-MeO-DiPT * 4-MeO-DMT * 5-BT * 5-Bromo-DMT * 5-CT * 5-Chloro-αMT * 5-Ethoxy-αMT * 5-Fluoro-αMT * 5-HO-αMT * 5-HO-DiPT * 5-HTP * 5-Ethoxy-DMT * 5-Ethyl-DMT * 5-Fluoro-DMT * 5-Methyl-DMT * 5-Methoxytryptamine * 5-MeO-7,N,N-TMT * 5-Methyl-αET * 5-MeO-αET * 5-MeO-αMT * 5-MeO-DALT * 5-MeO-DET * 5-MeO-DiPT * 5-MeO-DMT * 5-MeO-DPT * 5-MeO-EiPT * 5-MeO-EPT * 5-MeO-MALT * 5-MeO-MiPT * 5-MeO-NBpBrT * 5,7-Dihydroxytryptamine * 5-(Nonyloxy)tryptamine * 6-Fluoro-αMT * 6-Hydroxymelatonin * 7-Methyl-αET * 7-Methyl-DMT * Acetryptine * Aeruginascin * αET * AL-37350A * αMT * Baeocystin * BNC-210 * Bufotenidine * Bufotenin (5-HO-DMT) * BW-723C86 * Convolutindole A * DALT * Desformylflustrabromine * DET * DiPT * DMT * DPT * E-6801 * E-6837 * Ethocybin * EiPT * EMDT * EPT * FGIN-127 * FGIN-143 * HIOC * Ibogaine * Idalopirdine * Indorenate * Iprocin * Lespedamine * Luzindole * MET * MiPT * MPT * Miprocin * Melatonin * MS-245 * NAS * N-Feruloylserotonin * NMT * Norbaeocystin * Normelatonin * O-4310 * Oxypertine * Plakohypaphorine * PiPT * Psilocin (4-HO-DMT) * Psilocybin (4-PO-DMT) * Rizatriptan * Serotonin * ST-1936 * Sumatriptan * Tryptamine * Tryptophan * Yohimbine * Yuremamine * Zolmitriptan 0.00 (0 votes) | Retrieved from "https://handwiki.org/wiki/index.php?title=Chemistry:2,alpha-DMT&oldid=3194583" *[v]: View this template *[t]: Discuss this template *[e]: Edit this template