EPPTB

Identifiers

IUPAC name

* N-(3-ethoxyphenyl)-4-pyrrolidin-1-yl-3-trifluoromethylbenzamide

PubChem CID|

* 25175634

ChemSpider|

* 26387935

Chemical and physical data
Formula| C20H21F3N2O2
Molar mass| 378.395 g·mol−1
3D model (JSmol)|

* Interactive image
* Interactive image

SMILES

* CCOc2cc(ccc2)NC(=O)c(cc1C(F)(F)F)ccc1N3CCCC3

CCOc1cccc(c1)NC(=O)c2ccc(c(c2)C(F)(F)F)N3CCCC3

InChI

* InChI=1S/C20H21F3N2O2/c1-2-27-16-7-5-6-15(13-16)24-19(26)14-8-9-18(25-10-3-4-11-25)17(12-14)20(21,22)23/h5-9,12-13H,2-4,10-11H2,1H3,(H,24,26)

* Key:KLFVWQCQUXXLOU-UHFFFAOYSA-N

EPPTB (RO-5212773) is a drug developed by Hoffmann-La Roche which acts as a potent and selective inverse agonist of trace amine-associated receptor 1 (TAAR1), with no significant activity at other targets. EPPTB is one of the first selective antagonists developed for TAAR1, and has been used to demonstrate an important role for TAAR1 in regulation of dopaminergic signalling in the limbic system.[1] Although EPPTB has high affinity for the mouse TAAR1, it has much lower affinity for rat and human TAAR1, which limits its use in research.[2] While the human and mouse forms of TAAR1 have similar functions and bind similar ligands, the actual binding affinities of individual ligands often vary significantly between the two versions of the receptor.[3]

## See also[edit]

* RO5166017

## References[edit]

1. ^ Bradaia A, Trube G, Stalder H, Norcross RD, Ozmen L, Wettstein JG, et al. (November 2009). "The selective antagonist EPPTB reveals TAAR1-mediated regulatory mechanisms in dopaminergic neurons of the mesolimbic system". Proceedings of the National Academy of Sciences of the United States of America. 106 (47): 20081–6. Bibcode:2009PNAS..10620081B. doi:10.1073/pnas.0906522106. PMC 2785295. PMID 19892733.
2. ^ Stalder H, Hoener MC, Norcross RD (February 2011). "Selective antagonists of mouse trace amine-associated receptor 1 (mTAAR1): discovery of EPPTB (RO5212773)". Bioorganic & Medicinal Chemistry Letters. 21 (4): 1227–31. doi:10.1016/j.bmcl.2010.12.075. PMID 21237643.
3. ^ Hu LA, Zhou T, Ahn J, Wang S, Zhou J, Hu Y, Liu Q (October 2009). "Human and mouse trace amine-associated receptor 1 have distinct pharmacology towards endogenous monoamines and imidazoline receptor ligands". The Biochemical Journal. 424 (1): 39–45. doi:10.1042/BJ20090998. PMID 19725810. S2CID 21498991.

* v
* t
* e

Human trace amine-associated receptor ligands

TAAR1|

| Agonists|

| Endogenous†|

* Classical monoamine neurotransmitters
* Dopamine
* Histamine
* Norepinephrine
* Serotonin
* Trace amines
* 3-Iodothyronamine
* 3-Methoxytyramine
* N-Methylphenethylamine
* N-Methyltyramine
* m-Octopamine
* p-Octopamine
* Phenethylamine
* Phenylethanolamine
* Synephrine
* Tryptamine
* m-Tyramine
* p-Tyramine

|

Synthetic‡|

* Amphetamine
* DOB
* DOET
* 4-Hydroxyamphetamine
* Isoprenaline
* MDA (tenamfetamine)
* MDMA (midomafetamine)
* 2-Methylphenethylamine
* 3-Methylphenethylamine
* 4-Methylphenethylamine
* β-Methylphenethylamine
* Methamphetamine
* 3-MMA
* Norfenfluramine
* Phentermine
* o-PIT
* Propylhexedrine
* Ralmitaront (RG-7906, RO-6889450)
* RO5166017
* N,N-Dimethylphenethylamine
* Ulotaront (SEP-363856)

Neutral antagonists|

Inverse agonists|

* EPPTB (RO5212773)

TAAR2|

| Agonists‡|

|

Neutral antagonists|

TAAR5|

| Agonists‡|

* N,N-Dimethylethylamine
* Trimethylamine

|

Neutral antagonists|

Inverse agonists‡|

* 3-Iodothyronamine

† References for all endogenous human TAAR1 ligands are provided at List of trace amines

‡ References for synthetic TAAR1 agonists can be found at TAAR1 or in the associated compound articles. For TAAR2 and TAAR5 agonists and inverse agonists, see TAAR for references.

See also: Receptor/signaling modulators

This drug article relating to the nervous system is a stub. You can help Wikipedia by expanding it.

|

* v
* t
* e

*[CID]: Compound ID
*[v]: View this template
*[t]: Discuss this template
*[e]: Edit this template