Birnbaumins Birnbaumin A Birnbaumin B Identifiers 3D model (JSmol) * A: Interactive image * B: Interactive image PubChem CID * A: 136734815 * B: 136734816 InChI * A: InChI=1S/C16H20N6O4/c17-14(15(18)21-25)19-7-3-4-8-20-16(24)13(23)11-9-22(26)12-6-2-1-5-10(11)12/h1-2,5-6,9,19,26H,3-4,7-8,17-18H2,(H,20,24) Key: BTVKTPDEMYHRTI-UHFFFAOYSA-N * B: InChI=1S/C16H20N6O5/c17-14(15(18)21-26)19-6-1-2-7-20-16(25)13(24)10-8-22(27)12-9(10)4-3-5-11(12)23/h3-5,8,19,23,27H,1-2,6-7,17-18H2,(H,20,25) Key: FLACAKNDCLFMEK-UHFFFAOYSA-N SMILES * A: C1=CC=C2C(=C1)C(=CN2O)C(=O)C(=O)NCCCCNC(=C(N)N=O)N * B: C1=CC2=C(C(=C1)O)N(C=C2C(=O)C(=O)NCCCCNC(=C(N)N=O)N)O Properties Chemical formula | C16H20N6O4 (A) C16H20N6O5 (B) Hazards Main hazards | Toxic if ingested Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references Tracking categories (test): * SizeSet Birnbaumins are a pair of alkaloids and toxic yellow pigment compounds first isolated from the flowerpot parasol mushroom.[1] These toxins can cause gastric ulcers if consumed. ## References 1. ↑ Andrea Bartsch; Monika Bross; Peter Spiteller; Michael Spiteller; Wolfgang Steglich (7 April 2005). "Birnbaumin A and B: Two Unusual 1-Hydroxyindole Pigments from the "Flower Pot Parasol" Leucocoprinus birnbaumii". Angew Chem Int Ed Engl 44 (19): 2957–2959. doi:10.1002/anie.200500082. PMID 15818629. 0.00 (0 votes) Original source: https://en.wikipedia.org/wiki/Birnbaumins. Read more | Retrieved from "https://handwiki.org/wiki/index.php?title=Chemistry:Birnbaumins&oldid=366973" *[CID]: Compound ID