Short description: Chemical compound Gaboxadol Clinical data ATC code| * none Identifiers IUPAC name * 4,5,6,7-tetrahydroisoxazolo[5,4-c]pyridin-3(2H)-one CAS Number| * 64603-91-4 Y PubChem CID| * 3448 IUPHAR/BPS| * 4322 ChemSpider| * 3330 Y UNII| * K1M5RVL18S KEGG| * D04282 Y ChEMBL| * ChEMBL312443 Y Chemical and physical data Formula| C6H8N2O2 Molar mass| 140.142 g·mol−1 3D model (JSmol)| * Interactive image SMILES * O=C1/C2=C(\ON1)CNCC2 InChI * InChI=1S/C6H8N2O2/c9-6-4-1-2-7-3-5(4)10-8-6/h7H,1-3H2,(H,8,9) Y * Key:ZXRVKCBLGJOCEE-UHFFFAOYSA-N Y NY (what is this?) (verify) Gaboxadol, also known as 4,5,6,7-tetrahydroisoxazolo(5,4-c)pyridin-3-ol (THIP), is a conformationally constrained derivative of the alkaloid muscimol that was first synthesized in 1977 by the Danish chemist Povl Krogsgaard-Larsen.[1] In the early 1980s gaboxadol was the subject of a series of pilot studies that tested its efficacy as an analgesic and anxiolytic, as well as a treatment for tardive dyskinesia, Huntington's disease, Alzheimer's disease, and spasticity.[1] It was not until 1996 that researchers attempted to harness gaboxadol's frequently reported sedative "adverse effect" for the treatment of insomnia, resulting in a series of clinical trials sponsored by Lundbeck and Merck.[1][2] In March, 2007, Merck and Lundbeck cancelled work on the drug, citing safety concerns and the failure of an efficacy trial. It acts on the GABA system, but in a different way from benzodiazepines, Z-Drugs, and barbiturates. Lundbeck states that gaboxadol also increases deep sleep (stage 4). Unlike benzodiazepines, THIP does not demonstrate reinforcement in mice or baboons despite activation of dopaminergic neurons in the ventral tegmental area.[3] In 2015, Lundbeck sold its rights to the molecule to Ovid Therapeutics, whose plan is to develop it for FXS and Angelman syndrome.[4] It is known internally in Ovid as OV101. ## See also * Amanita muscaria * CI-966 * Ganaxolone * Ibotenic acid ## References 1. ↑ 1.0 1.1 1.2 Morris, Hamilton (August 2013). "Gaboxadol". Harper's Magazine August 2013. http://harpers.org/archive/2013/08/gaboxadol/. Retrieved 2014-11-20. 2. ↑ US Patent 4278676 - Heterocyclic compounds 3. ↑ "GABA site agonist gaboxadol induces addiction-predicting persistent changes in ventral tegmental area dopamine neurons but is not rewarding in mice or baboons". The Journal of Neuroscience 32 (15): 5310–20. April 2012. doi:10.1523/JNEUROSCI.4697-11.2012. PMID 22496576. 4. ↑ Tirrell, Meg (16 April 2015). "Former Teva CEO's new gig at Ovid Therapeutics". CNBC. https://www.cnbc.com/id/102591288. ## External links * 4,5,6,7-tetrahydroisoxazolo(5,4-c)pyridin-3-ol at the US National Library of Medicine Medical Subject Headings (MeSH) * H. Lundbeck Website * Medical News Today article * Report of cancellation of development. * Gaboxadol * v * t * e Hypnotics/sedatives (N05C) GABAA| | Alcohols| * 2M2B * Chloralodol * Ethanol (alcohol) * Ethchlorvynol * Methylpentynol * Trichloroethanol | Barbiturates| * Allobarbital * Amobarbital * Aprobarbital * Barbital * Butabarbital * Butobarbital * Cyclobarbital * Ethallobarbital * Heptabarb * Hexobarbital * Mephobarbital * Methohexital * Narcobarbital * Pentobarbital * Phenallymal * Phenobarbital * Propylbarbital * Proxibarbal * Reposal * Secobarbital * Talbutal * Thiamylal * Thiopental * Thiotetrabarbital * Vinbarbital * Vinylbital Benzodiazepines| * Brotizolam * Cinolazepam * Climazolam * Doxefazepam * Estazolam * Flunitrazepam * Flurazepam * Flutoprazepam * Lorazepam * Loprazolam * Lormetazepam * Midazolam * Nimetazepam * Nitrazepam * Phenazepam * Quazepam * Temazepam * Triazolam Carbamates| * Carisoprodol * Emylcamate * Ethinamate * Hexapropymate * Meprobamate * Methocarbamol * Phenprobamate * Procymate * Tybamate Imidazoles| * Etomidate * Metomidate * Propoxate Monoureides| * Acecarbromal * Apronal (apronalide) * Bromisoval * Capuride * Carbromal * Ectylurea Neuroactive steroids| * Acebrochol * Allopregnanolone * Alphadolone * Alphaxolone * Eltanolone * Hydroxydione * Minaxolone * Progesterone Nonbenzodiazepines| * Eszopiclone * Indiplon * Lirequinil * Necopidem * Pazinaclone * Saripidem * Suproclone * Suriclone * Zaleplon * Zolpidem * Zopiclone Phenols| * Propofol Piperidinediones| * Glutethimide * Methyprylon * Pyrithyldione * Piperidione Quinazolinones| * Afloqualone * Cloroqualone * Diproqualone * Etaqualone * Mebroqualone * Mecloqualone * Methaqualone * Methylmethaqualone * Nitromethaqualone Others| * Acetophenone * Acetylglycinamide chloral hydrate * Bromide compounds * Lithium bromide * Potassium bromide * Sodium bromide * Centalun * Chloral betaine * Chloral hydrate * Chloralose * Clomethiazole * Dichloralphenazone * Gaboxadol * Kavalactones * Loreclezole * Paraldehyde * Petrichloral * Sulfonylalkanes * Sulfonmethane (sulfonal) * Tetronal * Trional * Triclofos * Sesquiterpene * Isovaleramide * Isovaleric acid * Valerenic acid GABAB| * 1,4-Butanediol * 4-Fluorophenibut * Aceburic acid * Baclofen * GABOB * GHB (sodium oxybate) * GBL * GVL * Phenibut * Tolibut H1| | Antihistamines| * Captodiame * Cyproheptadine * Diphenhydramine * Doxylamine * Hydroxyzine * Methapyrilene * Perlapine * Pheniramine * Promethazine * Propiomazine | Antidepressants| * Serotonin antagonists and reuptake inhibitors * Etoperidone * Nefazodone * Trazodone * Tricyclic antidepressants * Amitriptyline * Doxepin * Trimipramine, etc. * Tetracyclic antidepressants * Mianserin * Mirtazapine, etc. Antipsychotics| * Typical antipsychotics * Chlorpromazine * Thioridazine, etc. * Atypical antipsychotics * Olanzapine * Quetiapine * Risperidone, etc. α2-Adrenergic| * Clonidine * Detomidine * Dexmedetomidine * Lofexidine * Medetomidine * Romifidine * Tizanidine * Xylazine 5-HT2A| | Antidepressants| * Trazodone * Tricyclic antidepressants * Amitriptyline * Doxepin * Trimipramine, etc. * Tetracyclic antidepressants * Mianserin * Mirtazapine, etc. | Antipsychotics| * Typical antipsychotics * Chlorpromazine * Thioridazine, etc. * Atypical antipsychotics * Olanzapine * Quetiapine * Risperidone, etc. Others| * Niaprazine Melatonin| * Agomelatine * Melatonin * Ramelteon * Tasimelteon Orexin| * Almorexant * Filorexant * Suvorexant α2δ VDCC| * Gabapentin * Gabapentin enacarbil * Mirogabalin * Phenibut * Pregabalin Others| * Cannabidiol * Cannabis * Chlorophenylalkyldiols * Fenpentadiol * Metaglycodol * Phenaglycodol * Diethylpropanediol * Evoxine * Fenadiazole * Guaifenesin-related muscle relaxants * Chlorphenesin * Mephenesin * Mephenoxalone * Metaxalone * Methocarbamol * Midaflur * Opioids (e.g., morphine) * Passion flower * Scopolamine * Trazodone * UMB68 * Valnoctamide {{Navbox | name = GABA receptor modulators | title = GABA receptor modulators | state = collapsed | bodyclass = hlist | groupstyle = text-align:center; | group1 = Ionotropic | list1 = {{Navbox|subgroup | groupstyle = text-align:center | groupwidth = 5em | group1 = GABAA | list1 = * Agonists: (+)-Catechin * Bamaluzole * Barbiturates (e.g., phenobarbital) * BL-1020 * DAVA * Dihydromuscimol * GABA * Gabamide * GABOB * Gaboxadol (THIP) * Homotaurine (tramiprosate, 3-APS) * Ibotenic acid * iso-THAZ * iso-THIP * Isoguvacine * Isomuscimol * Isonipecotic acid * Kojic amine * Lignans (e.g., honokiol) * Methylglyoxal * Monastrol * Muscimol * Nefiracetam * Neuroactive steroids (e.g., allopregnanolone) * Org 20599 * PF-6372865 * Phenibut * Picamilon * P4S * Progabide * Propofol * Quisqualamine * SL-75102 * TACA * TAMP * Terpenoids (e.g., borneol) * Thiomuscimol * Tolgabide * ZAPA * Positive modulators (abridged; see here for a full list): α-EMTBL * Alcohols (e.g., ethanol) * Anabolic steroids * Avermectins (e.g., ivermectin) * Barbiturates (e.g., phenobarbital) * Benzodiazepines (e.g., diazepam) * Bromide compounds (e.g., potassium bromide) * Carbamates (e.g., meprobamate) * Carbamazepine * Chloralose * Chlormezanone * Clomethiazole * Dihydroergolines (e.g., ergoloid (dihydroergotoxine)) * Etazepine * Etifoxine * Fenamates (e.g., mefenamic acid) * Flavonoids (e.g., apigenin, hispidulin) * Fluoxetine * Flupirtine * Imidazoles (e.g., etomidate) * Kava constituents (e.g., kavain) * Lanthanum * Loreclezole * Monastrol * Neuroactive steroids (e.g., allopregnanolone, [[Chemistry:Cholecholesterol]], THDOC) * Niacin * Nicotinamide (niacinamide) * Nonbenzodiazepines (e.g., β-carbolines (e.g., [[abecarnil), cyclopyrrolones (e.g., zopiclone), imidazopyridines (e.g., zolpidem), pyrazolopyrimidines (e.g., zaleplon)) * Norfluoxetine * Petrichloral * Phenols (e.g., propofol) * Phenytoin * Piperidinediones (e.g., glutethimide) * Propanidid * Pyrazolopyridines (e.g., etazolate) * Quinazolinones (e.g., methaqualone) * Retigabine (ezogabine) * ROD-188 * Skullcap constituents (e.g., baicalin) * Stiripentol * Sulfonylalkanes (e.g., sulfonmethane (sulfonal)) * Topiramate * Valerian constituents (e.g., valerenic acid) * Volatiles/gases (e.g., chloral hydrate, chloroform, [[Chemistry:Diethyl diethyl ether, Parparaldehyde]], sevoflurane) * Antagonists: Bicuculline * Coriamyrtin * Dihydrosecurinine * Gabazine (SR-95531) * Hydrastine * Hyenachin (mellitoxin) * PHP-501 * Pitrazepin * Securinine * Sinomenine * SR-42641 * SR-95103 * Thiocolchicoside * Tutin * Negative modulators: 1,3M1B * 3M2B * 11-Ketoprogesterone * 17-Phenylandrostenol * α5IA (LS-193,268) * β-CCB * β-CCE * β-CCM * β-CCP * β-EMGBL * Anabolic steroids * Amiloride * Anisatin * β-Lactams (e.g., penicillins, cephalosporins, carbapenems) * Basmisanil * Bemegride * Bicyclic phosphates (TBPS, TBPO, IPTBO) * BIDN * Bilobalide * Bupropion * CHEB * Chlorophenylsilatrane * Cicutoxin * Cloflubicyne * Cyclothiazide * DHEA * DHEA-S * Dieldrin * (+)-DMBB * DMCM * DMPC * EBOB * Etbicyphat * FG-7142 (ZK-31906) * Fiproles (e.g., fipronil) * Flavonoids (e.g., amentoflavone, oroxylin A) * Flumazenil * Fluoroquinolones (e.g., ciprofloxacin) * Flurothyl * Furosemide * Golexanolone * Iomazenil (123I) * IPTBO * Isopregnanolone (sepranolone) * L-655,708 * Laudanosine * Leptazol * Lindane * MaxiPost * Morphine * Morphine-3-glucuronide * MRK-016 * Naloxone * Naltrexone * Nicardipine * Nonsteroidal antiandrogens (e.g., [[apalutamide, [[Chemistry:Bicalutbicalutamide, Enzalutenzalutamide, Chemistry:Flutamide|flut]]amide]], nilutamide) * Oenanthotoxin * Pentylenetetrazol (pentetrazol) * Phenylsilatrane * Picrotoxin (i.e., picrotin, picrotoxinin and dihydropicrotoxinin) * Pregnenolone sulfate * Propybicyphat * PWZ-029 * Radequinil * Ro 15-4513 * Ro 19-4603 * RO4882224 * RO4938581 * Sarmazenil * SCS * Suritozole * TB-21007 * TBOB * TBPS * TCS-1105 * Terbequinil * TETS * Thujone * U-93631 * Zinc * ZK-93426 | group2 = GABAA-ρ | list2 = * Agonists: BL-1020 * CACA * CAMP * Homohypotaurine * GABA * GABOB * Ibotenic acid * Isoguvacine * Muscimol * N4-Chloroacetylcytosine arabinoside * Picamilon * Progabide * TACA * TAMP * Thiomuscimol * Tolgabide * Positive modulators: Allopregnanolone * Alphaxolone * ATHDOC * Lanthanides * Antagonists: (S)-2-MeGABA * (S)-4-ACPBPA * (S)-4-ACPCA * 2-MeTACA * 3-APMPA * 4-ACPAM * 4-GBA * cis-3-ACPBPA * CGP-36742 (SGS-742) * DAVA * Gabazine (SR-95531) * Gaboxadol (THIP) * I4AA * Isonipecotic acid * Loreclezole * P4MPA * P4S * SKF-97541 * SR-95318 * SR-95813 * TPMPA * trans-3-ACPBPA * ZAPA * Negative modulators: 5α-Dihydroprogesterone * Bilobalide * Loreclezole * Picrotoxin (picrotin, picrotoxinin) * Pregnanolone * ROD-188 * THDOC * Zinc | group2 = Metabotropic | list2 = GABAB| * Agonists: 1,4-Butanediol * 4-Fluorophenibut * Aceburic acid * Arbaclofen * Arbaclofen placarbil * Baclofen * BL-1020 * GABA * Gabamide * GABOB * GBL * GHB * GHBAL * GHV * GVL * Isovaline * Lesogaberan * Phenibut * Picamilon * Progabide * Sodium oxybate * SKF-97,541 * SL 75102 * Tolgabide * Tolibut * Positive modulators: ADX-71441 * BHF-177 * BHFF * BSPP * CGP-7930 * CGP-13501 * GS-39783 * rac-BHFF * KK-92A * Antagonists: 2-Hydroxysaclofen * CGP-35348 * CGP-46381 * CGP-52432 * CGP-54626 * CGP-55845 * CGP-64213 * DAVA * Homotaurine (tramiprosate, 3-APS) * Phaclofen * Saclofen * SCH-50911 * SKF-97541 * Negative modulators: Compound 14 | | below = See also Receptor/signaling modulators GABAA receptor positive modulators GABA metabolism/transport modulators * v * t * e Glycine receptor modulators Receptor (ligands)| | GlyR| * Agonists: β-Alanine * β-ABA (BABA) * β-AIBA * Caesium * D-Alanine * D-Serine * GABA * Glycine * Hypotaurine * Ivermectin * L-Alanine * L-Proline * L-Serine * L-Threonine * MDL-27531 * Milacemide * Picolinic acid * Propofol * Quisqualamine * Sarcosine * Taurine * Positive modulators: Alcohols (e.g., brometone, chlorobutanol (chloretone), ethanol (alcohol), tert-butanol (2M2P), tribromoethanol, trichloroethanol, trifluoroethanol) * Alkylbenzene sulfonate * Anandamide * Barbiturates (e.g., pentobarbital, sodium thiopental) * Chlormethiazole * D12-116 * Dihydropyridines (e.g., nicardipine) * Etomidate * Ginseng constituents (e.g., ginsenosides (e.g., ginsenoside-Rf)) * Glutamic acid (glutamate) * Ivermectin * Ketamine * Neuroactive steroids (e.g., alfaxolone, pregnenolone (eltanolone), pregnenolone acetate, minaxolone, ORG-20599) * Nitrous oxide * Penicillin G * Propofol * Tamoxifen * Tetrahydrocannabinol * Triclofos * Tropeines (e.g., atropine, bemesetron, cocaine, LY-278584, tropisetron, zatosetron) * Volatiles/gases (e.g., chloral hydrate, chloroform, desflurane, diethyl ether (ether), enflurane, halothane, isoflurane, methoxyflurane, sevoflurane, toluene, trichloroethane (methyl chloroform), trichloroethylene) * Xenon * Zinc * Antagonists: 2-Aminostrychnine * 2-Nitrostrychnine * 4-Phenyl-4-formyl-N-methylpiperidine * αEMBTL * Bicuculline * Brucine * Cacotheline * Caffeine * Colchicine * Colubrine * Cyanotriphenylborate * Dendrobine * Diaboline * Endocannabinoids (e.g., 2-AG, anandamide (AEA)) * Gaboxadol (THIP) * Gelsemine * iso-THAZ * Isobutyric acid * Isonipecotic acid * Isostrychnine * Laudanosine * N-Methylbicuculline * N-Methylstrychnine * N,N-Dimethylmuscimol * Nipecotic acid * Pitrazepin * Pseudostrychnine * Quinolines (e.g., 4-hydroxyquinoline, 4-hydroxyquinoline-3-carboxylic acid, 5,7-CIQA, 7-CIQ, 7-TFQ, 7-TFQA) * RU-5135 * Sinomenine * Strychnine * Thiocolchicoside * Tutin * Negative modulators: Amiloride * Benzodiazepines (e.g., bromazepam, Chemistry:Clonazepam | NMDAR| * See here instead. Transporter (blockers)| | GlyT1| * ACPPB * ALX-1393 * ALX-5407 (NFPS) * AMG-747 * ASP2535 * BIIB-104 (PF-04958242) * Bitopertin (RG1678/RO4917838) * CP-802079 * Ethanol (alcohol) * Glycyldodecylamide * GSK1018921 * LY-2365109 * ORG-24598 * ORG-25935 (SCH-900435) * PF-02545920 * PF-03463275 * Sarcosine * SSR-103,800 * SSR-504,734 | GlyT2| * Amoxapine * Ethanol (alcohol) * NAGly * Opiranserin (VVZ-149) * ORG-25543 * VVZ-368 See also Receptor/signaling modulators GABA receptor modulators GABAA receptor positive modulators Ionotropic glutamate receptor modulators 0.00 (0 votes) Original source: https://en.wikipedia.org/wiki/Gaboxadol. Read more | Retrieved from "https://handwiki.org/wiki/index.php?title=Chemistry:Gaboxadol&oldid=2209611" *[CID]: Compound ID *[v]: View this template *[t]: Discuss this template *[e]: Edit this template *[α2δ]: alpha2delta subunit *[VDCC]: voltage-gated calcium channel *[GABA]: γ-Aminobutyric acid *[GABAA]: γ-Aminobutyric acid A receptor *[GABAA-ρ]: γ-Aminobutyric acid A-rho receptor *[GABAB]: γ-Aminobutyric acid B receptor *[GlyR]: Glycine receptor *[NMDAR]: N-Methyl-D-aspartate receptor *[GlyT1]: Glycine transporter 1 *[GlyT2]: Glycine transporter 2