Chemical compound 4-Fluoro-alpha-PHP Identifiers IUPAC name * 1-(4-fluorophenyl)-2-(pyrrolidin-1-yl)hexan-1-one CAS Number| * 2230706-09-7 PubChem CID| * 132989300 Chemical and physical data Formula| C16H22FNO Molar mass| 263.356 g·mol−1 3D model (JSmol)| * Interactive image SMILES * CCCCC(C(=O)C1=CC=C(C=C1)F)N2CCCC2 InChI * InChI=1S/C16H22FNO/c1-2-3-6-15(18-11-4-5-12-18)16(19)13-7-9-14(17)10-8-13/h7-10,15H,2-6,11-12H2,1H3 * Key:BCJXLSGKMNRRKO-UHFFFAOYSA-N 4-Fluoro-alpha-PHP (4F-PHP) is a recreational designer drug from the substituted cathinone family with stimulant effects, which first appeared on the illicit market in around 2017.[1][2][3] ## See also[edit] * α-PHP * 3F-PVP * 3F-NEH * 3F-PiHP * 4F-PVP * 4Cl-PVP * 4F-POP * MFPVP * MDPHP * N-Ethylhexedrone * N-Ethylhexylone ## References[edit] 1. ^ Liu C, Jia W, Li T, Hua Z, Qian Z (August 2017). "Identification and analytical characterization of nine synthetic cathinone derivatives N-ethylhexedrone, 4-Cl-pentedrone, 4-Cl-α-EAPP, propylone, N-ethylnorpentylone, 6-MeO-bk-MDMA, α-PiHP, 4-Cl-α-PHP, and 4-F-α-PHP". Drug Testing and Analysis. 9 (8): 1162–1171. doi:10.1002/dta.2136. PMID 27863142. 2. ^ Apirakkan O, Frinculescu A, Shine T, Parkin MC, Cilibrizzi A, Frascione N, Abbate V (February 2018). "Analytical characterization of three cathinone derivatives, 4-MPD, 4F-PHP and bk-EPDP, purchased as bulk powder from online vendors". Drug Testing and Analysis. 10 (2): 372–378. doi:10.1002/dta.2218. PMID 28544816. 3. ^ Eshleman AJ, Nagarajan S, Wolfrum KM, Reed JF, Swanson TL, Nilsen A, Janowsky A (March 2019). "Structure-activity relationships of bath salt components: substituted cathinones and benzofurans at biogenic amine transporters". Psychopharmacology. 236 (3): 939–952. doi:10.1007/s00213-018-5059-5. PMC 6500773. PMID 30397775. * v * t * e Stimulants Adamantanes| * Adapromine * Amantadine * Bromantane * Memantine * Rimantadine Adenosine antagonists| * 8-Chlorotheophylline * 8-Cyclopentyltheophylline * 8-Phenyltheophylline * Aminophylline * Caffeine * CGS-15943 * Dimethazan * Istradefylline * Paraxanthine * SCH-58261 * Theobromine * Theophylline Alkylamines| * Cyclopentamine * Cypenamine * Cyprodenate * Heptaminol * Isometheptene * Levopropylhexedrine * Methylhexaneamine * Octodrine * Propylhexedrine * Tuaminoheptane Ampakines| * CX-516 * CX-546 * CX-614 * CX-691 * CX-717 * IDRA-21 * LY-404,187 * LY-503,430 * Nooglutyl * Org 26576 * PEPA * S-18986 * Sunifiram * Unifiram Arylcyclohexylamines| * Benocyclidine * Dieticyclidine * Esketamine * Eticyclidine * Gacyclidine * Ketamine * Phencyclamine * Phencyclidine * Rolicyclidine * Tenocyclidine * Tiletamine Benzazepines| * 6-Br-APB * SKF-77434 * SKF-81297 * SKF-82958 Cathinones| * 3-Fluoromethcathinone * 3,4-DMMC * 4-BMC * 4-CMC * 4-Methylbuphedrone * 4-Methylcathinone * 4-MEAP * 4-Methylpentedrone * Amfepramone * Benzedrone * Buphedrone * Bupropion * Butylone * Cathinone * Dimethylcathinone * Ethcathinone * Ethylone * Flephedrone * Hexedrone * Isoethcathinone * Mephedrone * Methcathinone * Methedrone * Methylenedioxycathinone * Methylone * Mexedrone * N-Ethylbuphedrone * N-Ethylhexedrone * Pentedrone * Pentylone * Phthalimidopropiophenone Cholinergics| * A-84,543 * A-366,833 * ABT-202 * ABT-418 * AR-R17779 * Altinicline * Anabasine * Arecoline * Bradanicline * Cotinine * Cytisine * Dianicline * Epibatidine * Epiboxidine * GTS-21 * Ispronicline * Nicotine * PHA-543,613 * PNU-120,596 * PNU-282,987 * Pozanicline * Rivanicline * Sazetidine A * SIB-1553A * SSR-180,711 * TC-1698 * TC-1827 * TC-2216 * Tebanicline * UB-165 * Varenicline * WAY-317,538 Convulsants| * Anatoxin-a * Bicuculline * DMCM * Flurothyl * Gabazine * Pentetrazol * Picrotoxin * Strychnine * Thujone Eugeroics| * Adrafinil * Armodafinil * CRL-40,940 * CRL-40,941 * Fluorenol * Modafinil Oxazolines| * 4-Methylaminorex * Aminorex * Clominorex * Cyclazodone * Fenozolone * Fluminorex * Pemoline * Thozalinone Phenethylamines| * 1-(4-Methylphenyl)-2-aminobutane * 1-Methylamino-1-(3,4-methylenedioxyphenyl)propane * 2-Fluoroamphetamine * 2-Fluoromethamphetamine * 2-OH-PEA * 2-Phenyl-3-aminobutane * 2,3-MDA * 3-Fluoroamphetamine * 3-Fluoroethamphetamine * 3-Methoxyamphetamine * 3-Methylamphetamine * 4-Fluoroamphetamine * 4-Fluoromethamphetamine * 4-MA * 4-MMA * 4-MTA * 6-FNE * AL-1095 * Alfetamine * a-Ethylphenethylamine * Amfecloral * Amfepentorex * Amidephrine * 2-Amino-1,2-dihydronaphthalene * 2-Aminoindane * 5-(2-Aminopropyl)indole * 2-Aminotetralin * Acridorex * Amphetamine (Dextroamphetamine, Levoamphetamine) * Amphetaminil * Arbutamine * β-Methylphenethylamine * β-Phenylmethamphetamine * Benfluorex * Benzphetamine * BDB * BOH * 3-Benzhydrylmorpholine * BPAP * Camfetamine * Cathine * Chlorphentermine * Cilobamine * Cinnamedrine * Clenbuterol * Clobenzorex * Cloforex * Clortermine * Cypenamine * D-Deprenyl * Denopamine * Dimethoxyamphetamine * Dimethylamphetamine * Dobutamine * DOPA (Dextrodopa, Levodopa) * Dopamine * Dopexamine * Droxidopa * EBDB * Ephedrine * Epinephrine * Epinine * Etafedrine * Ethylnorepinephrine * Etilamfetamine * Etilefrine * Famprofazone * Fencamfamin * Fencamine * Fenethylline * Fenfluramine (Dexfenfluramine, Levofenfluramine) * Fenproporex * Feprosidnine * Fludorex * Formetorex * Furfenorex * Gepefrine * Hexapradol * HMMA * Hordenine * 4-Hydroxyamphetamine * 5-Iodo-2-aminoindane * Ibopamine * Indanylamphetamine * Iofetamine * Isoetarine * Isoprenaline * L-Deprenyl (Selegiline) * Lefetamine * Lisdexamfetamine * Lophophine * MBDB * MDA (tenamfetamine) * MDBU * MDEA * MDMA (midomafetamine) * MDMPEA * MDOH * MDPR * MDPEA * Mefenorex * Mephentermine * Metanephrine * Metaraminol * Mesocarb * Methamphetamine (Dextromethamphetamine, Levomethamphetamine) * Methoxamine * Methoxyphenamine * MMA * Methoxyphenamine * MMDA * MMDMA * MMMA * Morforex * N,alpha-Diethylphenylethylamine * N,N-Dimethylphenethylamine * Naphthylamphetamine * Nisoxetine * Norepinephrine * Norfenefrine * Norfenfluramine * Normetanephrine * L-Norpseudoephedrine * Octopamine * Orciprenaline * Ortetamine * Oxifentorex * Oxilofrine * PBA * PCA * PCMA * PHA * Pentorex * Phenatine * Phenpromethamine * Phentermine * Phenylalanine * Phenylephrine * Phenylpropanolamine * Pholedrine * PIA * PMA * PMEA * PMMA * PPAP * Prenylamine * Propylamphetamine * Pseudoephedrine * Ropinirole * Salbutamol (Levosalbutamol) * Sibutramine * Solriamfetol * Synephrine * Theodrenaline * Tiflorex * Tranylcypromine * Tyramine * Tyrosine * Xylopropamine * Zylofuramine Phenylmorpholines| * 3-Fluorophenmetrazine * Fenbutrazate * Fenmetramide * G-130 * Manifaxine * Morazone * Morforex * Oxaflozane * PD-128,907 * Phendimetrazine * Phenmetrazine * 2-Phenyl-3,6-dimethylmorpholine * Pseudophenmetrazine * Radafaxine Piperazines| * 2C-B-BZP * 3C-PEP * BZP * CM156 * DBL-583 * GBR-12783 * GBR-12935 * GBR-13069 * GBR-13098 * GBR-13119 * MeOPP * MBZP * oMPP * Vanoxerine Piperidines| * 1-Benzyl-4-(2-(diphenylmethoxy)ethyl)piperidine * 2-Benzylpiperidine * 2-Methyl-3-phenylpiperidine * 3,4-Dichloromethylphenidate * 4-Benzylpiperidine * 4-Fluoromethylphenidate * 4-Methylmethylphenidate * Desoxypipradrol * Difemetorex * Diphenylpyraline * Ethylnaphthidate * Ethylphenidate * Methylnaphthidate * Isopropylphenidate * JZ-IV-10 * Methylphenidate (Dexmethylphenidate) * Nocaine * Phacetoperane * Pipradrol * Propylphenidate * SCH-5472 Pyrrolidines| * 2-Diphenylmethylpyrrolidine * 4-Cl-PVP * 5-DBFPV * α-PPP * α-PBP * α-PCYP * α-PHiP * α-PHP * α-PHPP * α-PVP * α-PVT * Diphenylprolinol * DMPVP * FPOP * FPVP * MDPPP * MDPBP * MPBP * MPHP * MPPP * MOPVP * MOPPP * Indapyrophenidone * MDPV * Naphyrone * PEP * Picilorex * Prolintane * Pyrovalerone Racetams| * Oxiracetam * Phenylpiracetam * Phenylpiracetam hydrazide Tropanes| * 4-fluorotropacocaine * 4'-Fluorococaine * Altropane (IACFT) * Brasofensine * CFT (WIN 35,428) * β-CIT (RTI-55) * Cocaethylene * Cocaine * Dichloropane (RTI-111) * Difluoropine * FE-β-CPPIT * FP-β-CPPIT * Ioflupane (123I) * Norcocaine * PIT * PTT * RTI-31 * RTI-32 * RTI-51 * RTI-112 * RTI-113 * RTI-120 * RTI-121 (IPCIT) * RTI-126 * RTI-150 * RTI-177 * RTI-229 * RTI-336 * RTI-354 * RTI-371 * RTI-386 * Salicylmethylecgonine * Tesofensine * Troparil (β-CPT, WIN 35,065-2) * Tropoxane * WF-23 * WF-33 Tryptamines| * 4-HO-αMT * 4-Methyl-αET * 4-Methyl-αMT * 5-Chloro-αMT * 5-Fluoro-αMT * 5-MeO-αET * 5-MeO-αMT * 5-MeO-DIPT * 6-Fluoro-αMT * 7-Methyl-αET * αET * αMT Others| * 2-MDP * 3,3-Diphenylcyclobutanamine * Amfonelic acid * Amineptine * Amiphenazole * Atipamezole * Atomoxetine * Bemegride * Benzydamine * BTQ * BTS 74,398 * Centanafadine * Ciclazindol * Clofenciclan * Cropropamide * Crotetamide * D-161 * Desipramine * Diclofensine * Dimethocaine * Efaroxan * Etamivan * Fenisorex * Fenpentadiol * Gamfexine * Gilutensin * GSK1360707F * GYKI-52895 * Hexacyclonate * Idazoxan * Indanorex * Indatraline * JNJ-7925476 * Lazabemide * Leptacline * Lomevactone * LR-5182 * Mazindol * Meclofenoxate * Medifoxamine * Mefexamide * Methamnetamine * Methastyridone * Methiopropamine * Naphthylaminopropane * Nefopam * Nikethamide * Nomifensine * O-2172 * Oxaprotiline * PNU-99,194 * PRC200-SS * Rasagiline * Rauwolscine * Rubidium chloride * Setazindol * Tametraline * Tandamine * Thiopropamine * Thiothinone * Trazium * UH-232 * Yohimbine ATC code: N06B This drug article relating to the nervous system is a stub. You can help Wikipedia by expanding it. | * v * t * e *[CID]: Compound ID *[v]: View this template *[t]: Discuss this template *[e]: Edit this template